CAS 1334490-02-6 is the registry number for 4-(1,3-Benzodioxol-5-yl)-2-hydrazinopyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]hydrazine (CAS 1334490-02-6) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: [4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]hydrazine. InChIKey: KIAOTMHMGZWUGY-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | [4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]hydrazine |
| InChIKey | KIAOTMHMGZWUGY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC(=NC=C3)NN |
Computed by PubChem (NCBI)