CAS 88192-21-6 is the registry number for 2-(3-azidopropyl)-isoindole-1, 3-dione. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3-azidopropyl)isoindole-1,3-dione (CAS 88192-21-6) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: 2-(3-azidopropyl)isoindole-1,3-dione. InChIKey: MMSQWAQECRXRGR-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-(3-azidopropyl)isoindole-1,3-dione |
| InChIKey | MMSQWAQECRXRGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCN=[N+]=[N-] |
Computed by PubChem (NCBI)