CAS 1738-50-7 is the registry number for 2-(5-Methyl-1H-1,2,3,4-tetrazol-1-yl)-3-phenylprop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoic acid (CAS 1738-50-7) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoic acid. InChIKey: PTBNDKSHTBGKBT-YFHOEESVSA-N.
| Molecular formula | C11H10N4O2 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoic acid |
| InChIKey | PTBNDKSHTBGKBT-YFHOEESVSA-N |
| SMILES | CC1=NN=NN1/C(=C\C2=CC=CC=C2)/C(=O)O |
Computed by PubChem (NCBI)