Products 1380500-88-8
CAS 1380500-88-8 appears in our catalog under these names: Methyltetrazine-acid, 95%, Methyltetrazine–acid, MeTz-PhAcOH, Methyltetrazine-acid, Methyltetrazine-acid 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 25mg, 500mg, 0,05g, 0,1g, 0,25g, 0,5g.
2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetic acid (CAS 1380500-88-8) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetic acid. InChIKey: TZNOWMYISKGWCY-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetic acid |
| InChIKey | TZNOWMYISKGWCY-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl)acetic acid, 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetic acid, Methyltetrazine-Acid, Methyltetrazine acid, Methyltetrazine-phenylacetic acid, Methyltetrazine-cid, MeTz-PhAcOH, 2-[4-(6-methyl-1,2,4,5-tetrazine-3-yl)phenyl]acetic acid, orb1909339, Methyltetrazine Acid (CCT-1125)