CAS 1565845-71-7 is the registry number for 2-(1,6-Naphthyridin-2-ylformamido)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(2-amino-2-oxoethyl)-1,6-naphthyridine-2-carboxamide (CAS 1565845-71-7) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: N-(2-amino-2-oxoethyl)-1,6-naphthyridine-2-carboxamide. InChIKey: JLDMNPYDBNBMSK-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | N-(2-amino-2-oxoethyl)-1,6-naphthyridine-2-carboxamide |
| InChIKey | JLDMNPYDBNBMSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=NC=C2)C(=O)NCC(=O)N |
Computed by PubChem (NCBI)