Products 67536-13-4

CAS 67536-13-4 is the registry number for Hydralazine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(phthalazin-1-ylhydrazinylidene)propanoic acid (CAS 67536-13-4) is a chemical compound with the molecular formula C11H10N4O2 and a molecular weight of 230.22 g/mol. IUPAC name: 2-(phthalazin-1-ylhydrazinylidene)propanoic acid. InChIKey: CXGHHASVNBBLOU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N4O2
Molecular weight230.22 g/mol
IUPAC name2-(phthalazin-1-ylhydrazinylidene)propanoic acid
InChIKeyCXGHHASVNBBLOU-UHFFFAOYSA-N
SMILESCC(=NNC1=NN=CC2=CC=CC=C21)C(=O)O

Computed by PubChem (NCBI)