CAS 1335050-80-0 is the registry number for 2-(tert-Butoxycarbonyl)isoxazolidine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(2-methylpropan-2-yl)oxycarbonyl]-1,2-oxazolidine-3-carboxylic acid (CAS 1335050-80-0) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,2-oxazolidine-3-carboxylic acid. InChIKey: FQNQHKBAZFREIU-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,2-oxazolidine-3-carboxylic acid |
| InChIKey | FQNQHKBAZFREIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(CCO1)C(=O)O |
Computed by PubChem (NCBI)