Products 1335056-02-4

CAS 1335056-02-4 is the registry number for 1,3-Dibenzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1,3-dibenzyl-2,4-dioxopyrimidine-5-carboxylic acid (CAS 1335056-02-4) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 1,3-dibenzyl-2,4-dioxopyrimidine-5-carboxylic acid. InChIKey: YNQVGDMXMOZLTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16N2O4
Molecular weight336.3 g/mol
IUPAC name1,3-dibenzyl-2,4-dioxopyrimidine-5-carboxylic acid
InChIKeyYNQVGDMXMOZLTJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C=C(C(=O)N(C2=O)CC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)