CAS 127273-06-7 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–cyanopropanoic acid, Fmoc-b-cyano-L-alanine, Fmoc-Ala(CN)-OH 97%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyanopropanoic acid, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyanopropanoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 500mg, 1000mg, 5000mg.
(2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 127273-06-7) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FJSOTHAUCCEZLI-KRWDZBQOSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FJSOTHAUCCEZLI-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC#N)C(=O)O |
Computed by PubChem (NCBI)