CAS 90098-03-6 is the registry number for 2–Benzamido–3–(2–oxo–1,2–dihydroquinolin–4–yl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-benzamido-3-(2-oxo-1H-quinolin-4-yl)propanoic acid (CAS 90098-03-6) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 2-benzamido-3-(2-oxo-1H-quinolin-4-yl)propanoic acid. InChIKey: WPXPRJVFLONKAC-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 2-benzamido-3-(2-oxo-1H-quinolin-4-yl)propanoic acid |
| InChIKey | WPXPRJVFLONKAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(CC2=CC(=O)NC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)