Products 195189-45-8
CAS 195189-45-8 appears in our catalog under these names: 3,5-Bis(4-aminophenoxy)benzoic acid, 95%, 3,5-Bis(4-aminophenoxy)benzoic acid, 96%, 3，5–Bis(4–aminophenoxy)benzoic Acid, 3,5-Bis(4-aminophenoxy)benzoic Acid, >96.0%(HPLC), 3,5-Bis(4-aminophenoxy)benzoic Acid. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 250mg, 1g, 200mg.
3,5-bis(4-aminophenoxy)benzoic acid (CAS 195189-45-8) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 3,5-bis(4-aminophenoxy)benzoic acid. InChIKey: KPKOSOUTWDOOIW-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 3,5-bis(4-aminophenoxy)benzoic acid |
| InChIKey | KPKOSOUTWDOOIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=CC(=C2)C(=O)O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)