Products 406938-39-4
CAS 406938-39-4 appears in our catalog under these names: Tadalafil Impurity R, Tadalafil Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 406938-39-4) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: MDXJJOKTGDJRNN-RHSMWYFYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | MDXJJOKTGDJRNN-RHSMWYFYSA-N |
| SMILES | C1[C@@H](N[C@@H](C2=C1C3=CC=CC=C3N2)C4=CC5=C(C=C4)OCO5)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Tadalafil Impurity R