CAS 1820575-73-2 appears in our catalog under these names: Fmoc-D-Ala(3-CN)-OH, 96%, FMOC–D–ALA(3–CN)–OH, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyanopropanoic acid, 95%, 95%, Propanoic acid, 3-cyano-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (2R)-, 98%, Fmoc-D-(3-CN)-Ala-OH, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1820575-73-2) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (2R)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FJSOTHAUCCEZLI-QGZVFWFLSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2R)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FJSOTHAUCCEZLI-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC#N)C(=O)O |
Computed by PubChem (NCBI)