Products 1335669-90-3
CAS 1335669-90-3 is the registry number for (R)-2-Chloro-5-(2-hydroxy-1-(methylamino)ethyl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-[(1R)-2-hydroxy-1-(methylamino)ethyl]phenol (CAS 1335669-90-3) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-chloro-5-[(1R)-2-hydroxy-1-(methylamino)ethyl]phenol. InChIKey: HLPIYOXHTHRODZ-QMMMGPOBSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-chloro-5-[(1R)-2-hydroxy-1-(methylamino)ethyl]phenol |
| InChIKey | HLPIYOXHTHRODZ-QMMMGPOBSA-N |
| SMILES | CN[C@@H](CO)C1=CC(=C(C=C1)Cl)O |
Computed by PubChem (NCBI)