Products 133605-26-2
CAS 133605-26-2 is the registry number for 2-(Bromomethyl)-1-nitro-3-(trifluoromethyl)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(bromomethyl)-1-nitro-3-(trifluoromethyl)benzene (CAS 133605-26-2) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 2-(bromomethyl)-1-nitro-3-(trifluoromethyl)benzene. InChIKey: WOHIRSIRDGJACD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 2-(bromomethyl)-1-nitro-3-(trifluoromethyl)benzene |
| InChIKey | WOHIRSIRDGJACD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])CBr)C(F)(F)F |
Computed by PubChem (NCBI)