CAS 133620-75-4 appears in our catalog under these names: 1-Chloro-4-(cyclopentyloxy)benzene, 98%, 1-Chloro-4-(cyclopentyloxy)benzene, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 100mg, 5g, 250mg, 1g.
1-chloro-4-cyclopentyloxybenzene (CAS 133620-75-4) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-chloro-4-cyclopentyloxybenzene. InChIKey: FKQKQCBLRSMFKX-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-chloro-4-cyclopentyloxybenzene |
| InChIKey | FKQKQCBLRSMFKX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)