CAS 1336248-39-5 is the registry number for (S)-3-(3,4-Dichlorophenyl)piperidine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(3S)-3-(3,4-dichlorophenyl)piperidine (CAS 1336248-39-5) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: (3S)-3-(3,4-dichlorophenyl)piperidine. InChIKey: ICQSKAQXLPIUOE-SECBINFHSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | (3S)-3-(3,4-dichlorophenyl)piperidine |
| InChIKey | ICQSKAQXLPIUOE-SECBINFHSA-N |
| SMILES | C1C[C@H](CNC1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)