CAS 1336777-30-0 is the registry number for (3R)-3-(3,4-DICHLOROPHENYL)PIPERIDINE, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-(3,4-dichlorophenyl)piperidine (CAS 1336777-30-0) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: (3R)-3-(3,4-dichlorophenyl)piperidine. InChIKey: ICQSKAQXLPIUOE-VIFPVBQESA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | (3R)-3-(3,4-dichlorophenyl)piperidine |
| InChIKey | ICQSKAQXLPIUOE-VIFPVBQESA-N |
| SMILES | C1C[C@@H](CNC1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)