Products 147984-94-9

CAS 147984-94-9 is the registry number for N-Benzyloxycarbonylmethyl-succinamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid (CAS 147984-94-9) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: 4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid. InChIKey: WEOVRPLLSRMOFL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO5
Molecular weight265.26 g/mol
IUPAC name4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butanoic acid
InChIKeyWEOVRPLLSRMOFL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)CNC(=O)CCC(=O)O

Computed by PubChem (NCBI)