CAS 1339516-36-7 appears in our catalog under these names: 3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-thiol, 95%, 3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(3-methoxyphenyl)-2H-1,2,4-oxadiazole-5-thione (CAS 1339516-36-7) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 3-(3-methoxyphenyl)-2H-1,2,4-oxadiazole-5-thione. InChIKey: VWAFCJLWERTLAK-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | VWAFCJLWERTLAK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC(=S)ON2 |
Computed by PubChem (NCBI)