CAS 1339526-85-0 appears in our catalog under these names: 5-Acetyl-2,4-dimethylbenzene-1-sulfonamide, 95%, 5-Acetyl-2,4-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-acetyl-2,4-dimethylbenzenesulfonamide (CAS 1339526-85-0) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 5-acetyl-2,4-dimethylbenzenesulfonamide. InChIKey: BQVZVFNMAZELDM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 5-acetyl-2,4-dimethylbenzenesulfonamide |
| InChIKey | BQVZVFNMAZELDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)C)S(=O)(=O)N)C |
Computed by PubChem (NCBI)