Products 1339797-52-2
CAS 1339797-52-2 is the registry number for 2-(3-Chlorobenzyl)-2-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-chlorophenyl)methyl]-2-methylbutanoic acid (CAS 1339797-52-2) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 2-[(3-chlorophenyl)methyl]-2-methylbutanoic acid. InChIKey: LXNYQVTZWZQWHH-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)methyl]-2-methylbutanoic acid |
| InChIKey | LXNYQVTZWZQWHH-UHFFFAOYSA-N |
| SMILES | CCC(C)(CC1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3-Chlorobenzyl)-2-methylbutanoic acid