Products 134-25-8
CAS 134-25-8 appears in our catalog under these names: Alpha,alpha,2,4-tetrachlorotoluene, 98%, alpha,alpha,2,4-Tetrachlorotoluene, Alpha,alpha,2,4-tetrachlorotoluene, 97%, 2,4-Dichloro-1-(dichloromethyl)benzene, 97%, 2,4-DICHLOROBENZYL DICHLORIDE, 97%. Offered by: Combi-blocks, Biosynth, Chemat, BLDpharm, Fluorochem. Available pack sizes: 5g, 25g, 1g, 50g, 100mg, 250mg, 100g.
2,4-dichloro-1-(dichloromethyl)benzene (CAS 134-25-8) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 2,4-dichloro-1-(dichloromethyl)benzene. InChIKey: AQVKVGOTPBBVMS-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 2,4-dichloro-1-(dichloromethyl)benzene |
| InChIKey | AQVKVGOTPBBVMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(Cl)Cl |
Computed by PubChem (NCBI)