CAS 2136-81-4 appears in our catalog under these names: 1-chloro-3-(trichloromethyl)benzene, 3-Chlorobenzotrichloride, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 250mg, 1000mg, 500mg.
1-chloro-3-(trichloromethyl)benzene (CAS 2136-81-4) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 1-chloro-3-(trichloromethyl)benzene. InChIKey: ZVPXXRHACIEOFJ-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 1-chloro-3-(trichloromethyl)benzene |
| InChIKey | ZVPXXRHACIEOFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)