Products 56961-85-4
CAS 56961-85-4 is the registry number for 1,3-Dichloro-5-dichloromethyl-benzene. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dichloro-5-(dichloromethyl)benzene (CAS 56961-85-4) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 1,3-dichloro-5-(dichloromethyl)benzene. InChIKey: YARYAWIHMVXQQY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 1,3-dichloro-5-(dichloromethyl)benzene |
| InChIKey | YARYAWIHMVXQQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(Cl)Cl |
Computed by PubChem (NCBI)