CAS 2136-89-2 appears in our catalog under these names: 2–Chlorotrichlorotoluene, 2-Chlorobenzotrichloride, (2-Chlorophenyl)trichlormethane, 2-Chlorotrichlorotoluene 98%, 2-Chlorobenzotrichloride, >95% (HPLC). Offered by: GLPBio, Biosynth, Mikromol, Ambeed, TRC. Available pack sizes: 100g, 500g, 0,25g, 2,5g, 100mg, 25g, 50g, 5g.
1-chloro-2-(trichloromethyl)benzene (CAS 2136-89-2) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 1-chloro-2-(trichloromethyl)benzene. InChIKey: MFHPYLFZSCSNST-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 1-chloro-2-(trichloromethyl)benzene |
| InChIKey | MFHPYLFZSCSNST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)