CAS 56961-83-2 is the registry number for 2,5-Dichlorobenzylidene chloride. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichloro-2-(dichloromethyl)benzene (CAS 56961-83-2) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 1,4-dichloro-2-(dichloromethyl)benzene. InChIKey: VBPLROSJWVETJQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 1,4-dichloro-2-(dichloromethyl)benzene |
| InChIKey | VBPLROSJWVETJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(Cl)Cl)Cl |
Computed by PubChem (NCBI)