CAS 1424-79-9 is the registry number for 1,2,4-Trichloro-3-(chloromethyl)benzene, 97+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,4-trichloro-3-(chloromethyl)benzene (CAS 1424-79-9) is a chemical compound with the molecular formula C7H4Cl4 and a molecular weight of 229.9 g/mol. IUPAC name: 1,2,4-trichloro-3-(chloromethyl)benzene. InChIKey: HOLOJLLLDKVVJY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4 |
|---|---|
| Molecular weight | 229.9 g/mol |
| IUPAC name | 1,2,4-trichloro-3-(chloromethyl)benzene |
| InChIKey | HOLOJLLLDKVVJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CCl)Cl)Cl |
Computed by PubChem (NCBI)