CAS 13401-19-9 is the registry number for 6-Methyllumazine. Offered by: TRC. Available pack sizes: 1g.
6-methyl-1H-pteridine-2,4-dione (CAS 13401-19-9) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 6-methyl-1H-pteridine-2,4-dione. InChIKey: WJYWPPGNIKDDQP-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 6-methyl-1H-pteridine-2,4-dione |
| InChIKey | WJYWPPGNIKDDQP-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=N1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)