Products 1340322-21-5

CAS 1340322-21-5 is the registry number for 1-(9H-Fluoren-9-ylmethyl) 4-methyl piperidine-1,4-dicarboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

1-O-(9H-fluoren-9-ylmethyl) 4-O-methyl piperidine-1,4-dicarboxylate (CAS 1340322-21-5) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 4-O-methyl piperidine-1,4-dicarboxylate. InChIKey: KMNNYWDVPDTUQH-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23NO4
Molecular weight365.4 g/mol
IUPAC name1-O-(9H-fluoren-9-ylmethyl) 4-O-methyl piperidine-1,4-dicarboxylate
InChIKeyKMNNYWDVPDTUQH-UHFFFAOYSA-N
SMILESCOC(=O)C1CCN(CC1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)