Products 1340492-22-9
CAS 1340492-22-9 appears in our catalog under these names: 1,3-Diazaspiro(5.5)undecane-2,4-dione, 95%, 1,3-Diazaspiro(5.5)undecane-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-diazaspiro[5.5]undecane-2,4-dione (CAS 1340492-22-9) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 1,3-diazaspiro[5.5]undecane-2,4-dione. InChIKey: OFWUXAJZSPLBDL-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1,3-diazaspiro[5.5]undecane-2,4-dione |
| InChIKey | OFWUXAJZSPLBDL-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)