CAS 134052-68-9 is the registry number for (R)–4–Carboxyphenylglycine. Offered by: GLPBio. Available pack sizes: 10mg, 50mg.
4-[(R)-amino(carboxy)methyl]benzoic acid (CAS 134052-68-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-[(R)-amino(carboxy)methyl]benzoic acid. InChIKey: VTMJKPGFERYGJF-SSDOTTSWSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-[(R)-amino(carboxy)methyl]benzoic acid |
| InChIKey | VTMJKPGFERYGJF-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)