CAS 1341040-10-5 is the registry number for (S)-Benzyl (1-(methylsulfonyl)propan-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl N-[(2S)-1-methylsulfonylpropan-2-yl]carbamate (CAS 1341040-10-5) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: benzyl N-[(2S)-1-methylsulfonylpropan-2-yl]carbamate. InChIKey: VKGQMWVCEBJCSL-JTQLQIEISA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | benzyl N-[(2S)-1-methylsulfonylpropan-2-yl]carbamate |
| InChIKey | VKGQMWVCEBJCSL-JTQLQIEISA-N |
| SMILES | C[C@@H](CS(=O)(=O)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)