CAS 1341300-86-4 is the registry number for 3-Bromo-1-(4-bromophenyl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-bromo-1-(4-bromophenyl)pyrrolidin-2-one (CAS 1341300-86-4) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 3-bromo-1-(4-bromophenyl)pyrrolidin-2-one. InChIKey: QUUGICKQIQTLKC-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 3-bromo-1-(4-bromophenyl)pyrrolidin-2-one |
| InChIKey | QUUGICKQIQTLKC-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)