CAS 1342077-83-1 appears in our catalog under these names: 3-Bromo-1-(3-bromophenyl)pyrrolidin-2-one, 95%, 3-Bromo-1-(3-bromophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-1-(3-bromophenyl)pyrrolidin-2-one (CAS 1342077-83-1) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 3-bromo-1-(3-bromophenyl)pyrrolidin-2-one. InChIKey: YHPLZPNTZCHOSS-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 3-bromo-1-(3-bromophenyl)pyrrolidin-2-one |
| InChIKey | YHPLZPNTZCHOSS-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)