Products 19673-29-1
CAS 19673-29-1 is the registry number for 7,9-Dibromo-3,4-dihydro-1H-benzo[b]azepin-5(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-dibromo-1,2,3,4-tetrahydro-1-benzazepin-5-one (CAS 19673-29-1) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 7,9-dibromo-1,2,3,4-tetrahydro-1-benzazepin-5-one. InChIKey: UUDUHLGTILRDFO-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 7,9-dibromo-1,2,3,4-tetrahydro-1-benzazepin-5-one |
| InChIKey | UUDUHLGTILRDFO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=CC(=C2)Br)Br)NC1 |
Computed by PubChem (NCBI)