CAS 872271-71-1 is the registry number for 5,7-Dibromo-3,3-dimethyloxindole, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,7-dibromo-3,3-dimethyl-1H-indol-2-one (CAS 872271-71-1) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 5,7-dibromo-3,3-dimethyl-1H-indol-2-one. InChIKey: MJVOOYJHLGGINK-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 5,7-dibromo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | MJVOOYJHLGGINK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC(=C2)Br)Br)NC1=O)C |
Computed by PubChem (NCBI)