CAS 306935-84-2 is the registry number for 2,6-Dibromo-4-isopropylphenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1,3-dibromo-2-isocyanato-5-propan-2-ylbenzene (CAS 306935-84-2) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 1,3-dibromo-2-isocyanato-5-propan-2-ylbenzene. InChIKey: AIQYHXAROYBPBR-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 1,3-dibromo-2-isocyanato-5-propan-2-ylbenzene |
| InChIKey | AIQYHXAROYBPBR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)N=C=O)Br |
Computed by PubChem (NCBI)