CAS 935524-26-8 appears in our catalog under these names: 3,7-Dibromo-2,3,4,5-tetrahydro-1h-1-benzazepin-2-one, 95%, 3,7-Dibromo-2,3,4,5-tetrahydro-1H-1-benzazepin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g.
3,7-dibromo-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 935524-26-8) is a chemical compound with the molecular formula C10H9Br2NO and a molecular weight of 318.99 g/mol. IUPAC name: 3,7-dibromo-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: RUCQBVMURFKTHQ-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2NO |
|---|---|
| Molecular weight | 318.99 g/mol |
| IUPAC name | 3,7-dibromo-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | RUCQBVMURFKTHQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)NC(=O)C1Br |
Computed by PubChem (NCBI)