Products 1341323-06-5
CAS 1341323-06-5 is the registry number for 3-Amino-1-(3,4-dichlorophenyl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-1-(3,4-dichlorophenyl)piperidin-2-one (CAS 1341323-06-5) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 3-amino-1-(3,4-dichlorophenyl)piperidin-2-one. InChIKey: MMOFLOPYWLHIJJ-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 3-amino-1-(3,4-dichlorophenyl)piperidin-2-one |
| InChIKey | MMOFLOPYWLHIJJ-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)