CAS 13414-55-6 is the registry number for 2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
2,2-dimethyl-7-nitro-3H-1-benzofuran (CAS 13414-55-6) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2,2-dimethyl-7-nitro-3H-1-benzofuran. InChIKey: ZQZNLPNVEXRNNG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2,2-dimethyl-7-nitro-3H-1-benzofuran |
| InChIKey | ZQZNLPNVEXRNNG-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)