Products 1341527-09-0
CAS 1341527-09-0 is the registry number for (5-Chloro-2-thienyl)(3-hydroxy-1-azetidinyl)methanone. Offered by: TRC. Available pack sizes: 2,5g.
(5-chlorothiophen-2-yl)-(3-hydroxyazetidin-1-yl)methanone (CAS 1341527-09-0) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: (5-chlorothiophen-2-yl)-(3-hydroxyazetidin-1-yl)methanone. InChIKey: FCVRTRIBVGXFTB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (5-chlorothiophen-2-yl)-(3-hydroxyazetidin-1-yl)methanone |
| InChIKey | FCVRTRIBVGXFTB-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)C2=CC=C(S2)Cl)O |
Computed by PubChem (NCBI)