CAS 799012-78-5 appears in our catalog under these names: 5-Chloro-thiophene-2-carboxylic Acid, (S)-5-Chloro-N-(oxiran-2-ylmethyl)thiophene-2-carboxamide, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 1g, on request.
5-chloro-N-[[(2S)-oxiran-2-yl]methyl]thiophene-2-carboxamide (CAS 799012-78-5) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 5-chloro-N-[[(2S)-oxiran-2-yl]methyl]thiophene-2-carboxamide. InChIKey: LLRCNCXTSFGOGG-YFKPBYRVSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 5-chloro-N-[[(2S)-oxiran-2-yl]methyl]thiophene-2-carboxamide |
| InChIKey | LLRCNCXTSFGOGG-YFKPBYRVSA-N |
| SMILES | C1[C@@H](O1)CNC(=O)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)