Products 2819971-34-9

CAS 2819971-34-9 is the registry number for 4-Cyclopropylpyridine-2-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyclopropylpyridine-2-sulfonyl chloride (CAS 2819971-34-9) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 4-cyclopropylpyridine-2-sulfonyl chloride. InChIKey: MLFQDTYOVLRJRU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO2S
Molecular weight217.67 g/mol
IUPAC name4-cyclopropylpyridine-2-sulfonyl chloride
InChIKeyMLFQDTYOVLRJRU-UHFFFAOYSA-N
SMILESC1CC1C2=CC(=NC=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)