CAS 2819971-34-9 is the registry number for 4-Cyclopropylpyridine-2-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyclopropylpyridine-2-sulfonyl chloride (CAS 2819971-34-9) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 4-cyclopropylpyridine-2-sulfonyl chloride. InChIKey: MLFQDTYOVLRJRU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 4-cyclopropylpyridine-2-sulfonyl chloride |
| InChIKey | MLFQDTYOVLRJRU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)