Products 2854393-52-3

CAS 2854393-52-3 is the registry number for 6-Chloro-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide (CAS 2854393-52-3) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide. InChIKey: JHPRKYZWITWXGL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO2S
Molecular weight217.67 g/mol
IUPAC name6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide
InChIKeyJHPRKYZWITWXGL-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)NC2=C1C=C(C=C2)Cl

Computed by PubChem (NCBI)