CAS 2854393-52-3 is the registry number for 6-Chloro-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide (CAS 2854393-52-3) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide. InChIKey: JHPRKYZWITWXGL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide |
| InChIKey | JHPRKYZWITWXGL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)NC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)