CAS 1691781-05-1 is the registry number for 6,7-Dihydro-5H-cyclopenta(b)pyridine-3-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6,7-dihydro-5H-cyclopenta[b]pyridine-3-sulfonyl chloride (CAS 1691781-05-1) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[b]pyridine-3-sulfonyl chloride. InChIKey: CYSUAEMYJUZSHK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[b]pyridine-3-sulfonyl chloride |
| InChIKey | CYSUAEMYJUZSHK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)