CAS 1500183-05-0 appears in our catalog under these names: Methyl 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylate, 95%, Methyl 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylate (CAS 1500183-05-0) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: methyl 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylate. InChIKey: LBELSOFZUXTBKJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | methyl 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylate |
| InChIKey | LBELSOFZUXTBKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(S1)C2CC2)Cl |
Computed by PubChem (NCBI)