CAS 1342135-56-1 appears in our catalog under these names: 4-(Dimethyl-4H-1,2,4-triazol-3-yl)benzoic acid, 95%, 4-(Dimethyl-4H-1,2,4-triazol-3-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(4,5-dimethyl-1,2,4-triazol-3-yl)benzoic acid (CAS 1342135-56-1) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 4-(4,5-dimethyl-1,2,4-triazol-3-yl)benzoic acid. InChIKey: HTBDTXFBBBIGPI-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 4-(4,5-dimethyl-1,2,4-triazol-3-yl)benzoic acid |
| InChIKey | HTBDTXFBBBIGPI-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)