Products 1342539-28-9
CAS 1342539-28-9 is the registry number for 3-(3,4-Dichlorophenyl)tetrahydro-3-furanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3-(3,4-dichlorophenyl)oxolan-3-ol (CAS 1342539-28-9) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)oxolan-3-ol. InChIKey: PLAKETUVFTZANJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)oxolan-3-ol |
| InChIKey | PLAKETUVFTZANJ-UHFFFAOYSA-N |
| SMILES | C1COCC1(C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)