CAS 1342677-58-0 appears in our catalog under these names: 5-(2-Chlorophenyl)-1,2,4-oxadiazol-3-amine, 95%, 5-(2-Chlorophenyl)-1,2,4-oxadiazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(2-chlorophenyl)-1,2,4-oxadiazol-3-amine (CAS 1342677-58-0) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-(2-chlorophenyl)-1,2,4-oxadiazol-3-amine. InChIKey: VFBTTWWCHNHZJN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1,2,4-oxadiazol-3-amine |
| InChIKey | VFBTTWWCHNHZJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NO2)N)Cl |
Computed by PubChem (NCBI)